C11H21NO2 — CID 12682172
3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide (PubChem CID 12682172) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide.
| Compound Name | 3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide |
|---|---|
| PubChem CID | 12682172 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | 3-hydroxy-N,N-dimethyl-2-prop-1-en-2-ylhexanamide |
| SMILES | C=C(C)C(C(=O)N(C)C)C(O)CCC |
| InChI | InChI=1S/C11H21NO2/c1-6-7-9(13)10(8(2)3)11(14)12(4)5/h9-10,13H,2,6-7H2,1,3-5H3 |
| InChIKey | WHTDIJRMZHQIKZ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|