C9H18O4 — CID 102388386
(3S,4S)-4-hydroperoxy-2,2,5-trimethylhex-5-ene-1,3-diol (PubChem CID 102388386) has the molecular formula C9H18O4 and a molecular weight of 190.24 g/mol. Its IUPAC name is (3S,4S)-4-hydroperoxy-2,2,5-trimethylhex-5-ene-1,3-diol.
| Compound Name | (3S,4S)-4-hydroperoxy-2,2,5-trimethylhex-5-ene-1,3-diol |
|---|---|
| PubChem CID | 102388386 |
| Molecular Formula | C9H18O4 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.12 |
| IUPAC Name | (3S,4S)-4-hydroperoxy-2,2,5-trimethylhex-5-ene-1,3-diol |
| SMILES | C=C(C)[C@H](OO)[C@@H](O)C(C)(C)CO |
| InChI | InChI=1S/C9H18O4/c1-6(2)7(13-12)8(11)9(3,4)5-10/h7-8,10-12H,1,5H2,2-4H3/t7-,8+/m0/s1 |
| InChIKey | RRCTXGDWGIVWMY-JGVFFNPUSA-N |
| XLogP | 0.80 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|