C11H24O5 — CID 88739226
5-(2-hydroxypropoxy)-2,2-dimethylhexane-1,3,4-triol (PubChem CID 88739226) has the molecular formula C11H24O5 and a molecular weight of 236.31 g/mol. Its IUPAC name is 5-(2-hydroxypropoxy)-2,2-dimethylhexane-1,3,4-triol.
| Compound Name | 5-(2-hydroxypropoxy)-2,2-dimethylhexane-1,3,4-triol |
|---|---|
| PubChem CID | 88739226 |
| Molecular Formula | C11H24O5 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 5-(2-hydroxypropoxy)-2,2-dimethylhexane-1,3,4-triol |
| SMILES | CC(O)COC(C)C(O)C(O)C(C)(C)CO |
| InChI | InChI=1S/C11H24O5/c1-7(13)5-16-8(2)9(14)10(15)11(3,4)6-12/h7-10,12-15H,5-6H2,1-4H3 |
| InChIKey | RJRMXKOIQBIUBE-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |