C10H14S — CID 175121467
7-methyl-3-methylideneocta-1,6-diene-1-thione (PubChem CID 175121467) has the molecular formula C10H14S and a molecular weight of 166.29 g/mol. Its IUPAC name is 7-methyl-3-methylideneocta-1,6-diene-1-thione.
| Compound Name | 7-methyl-3-methylideneocta-1,6-diene-1-thione |
|---|---|
| PubChem CID | 175121467 |
| Molecular Formula | C10H14S |
| Molecular Weight | 166.29 g/mol |
| Exact Mass | 166.08 |
| IUPAC Name | 7-methyl-3-methylideneocta-1,6-diene-1-thione |
| SMILES | C=C(C=C=S)CCC=C(C)C |
| InChI | InChI=1S/C10H14S/c1-9(2)5-4-6-10(3)7-8-11/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | IGFPWOWKSKNIST-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.29 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|