C13H23NO2 — CID 54056647
methyl 3-imino-5,9-dimethyldec-8-enoate (PubChem CID 54056647) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is methyl 3-imino-5,9-dimethyldec-8-enoate.
| Compound Name | methyl 3-imino-5,9-dimethyldec-8-enoate |
|---|---|
| PubChem CID | 54056647 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | methyl 3-imino-5,9-dimethyldec-8-enoate |
| SMILES | [H]/N=C(\CC(=O)OC)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C13H23NO2/c1-10(2)6-5-7-11(3)8-12(14)9-13(15)16-4/h6,11,14H,5,7-9H2,1-4H3/b14-12- |
| InChIKey | LWSOCVBJKWDTAB-OWBHPGMISA-N |
| XLogP | 3.34 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|