C14H17NO3 — CID 73010512
N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]but-2-enamide (PubChem CID 73010512) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]but-2-enamide.
| Compound Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]but-2-enamide |
|---|---|
| PubChem CID | 73010512 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]but-2-enamide |
| SMILES | CC=CC(=O)NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C14H17NO3/c1-2-3-14(16)15-7-6-11-4-5-12-13(10-11)18-9-8-17-12/h2-5,10H,6-9H2,1H3,(H,15,16) |
| InChIKey | LUNWQOWWBJUOIR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|