C19H18FNO3 — CID 7761215
(E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-(3-fluorophenyl)prop-2-enamide (PubChem CID 7761215) has the molecular formula C19H18FNO3 and a molecular weight of 327.36 g/mol. Its IUPAC name is (E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-(3-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-(3-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 7761215 |
| Molecular Formula | C19H18FNO3 |
| Molecular Weight | 327.36 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | (E)-N-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)ethyl]-3-(3-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(F)c1)NCCc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C19H18FNO3/c20-16-3-1-2-14(12-16)5-7-19(22)21-9-8-15-4-6-17-18(13-15)24-11-10-23-17/h1-7,12-13H,8-11H2,(H,21,22)/b7-5+ |
| InChIKey | KMMNLCDHDFIDIG-FNORWQNLSA-N |
| XLogP | 2.97 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|