C19H17ClFNO3 — CID 24563528
(E)-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(4-fluorophenyl)prop-2-enamide (PubChem CID 24563528) has the molecular formula C19H17ClFNO3 and a molecular weight of 361.80 g/mol. Its IUPAC name is (E)-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(4-fluorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(4-fluorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 24563528 |
| Molecular Formula | C19H17ClFNO3 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (E)-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-(4-fluorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)NCCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C19H17ClFNO3/c20-16-11-14(12-17-19(16)25-10-9-24-17)7-8-22-18(23)6-3-13-1-4-15(21)5-2-13/h1-6,11-12H,7-10H2,(H,22,23)/b6-3+ |
| InChIKey | OWNVUWHGAWVIOM-ZZXKWVIFSA-N |
| XLogP | 3.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|