C23H27ClN2O5S — CID 55466899
(E)-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide (PubChem CID 55466899) has the molecular formula C23H27ClN2O5S and a molecular weight of 479.00 g/mol. Its IUPAC name is (E)-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 55466899 |
| Molecular Formula | C23H27ClN2O5S |
| Molecular Weight | 479.00 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | (E)-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-3-[4-(diethylsulfamoyl)phenyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(/C=C/C(=O)NCCc2cc(Cl)c3c(c2)OCCO3)cc1 |
| InChI | InChI=1S/C23H27ClN2O5S/c1-3-26(4-2)32(28,29)19-8-5-17(6-9-19)7-10-22(27)25-12-11-18-15-20(24)23-21(16-18)30-13-14-31-23/h5-10,15-16H,3-4,11-14H2,1-2H3,(H,25,27)/b10-7+ |
| InChIKey | CKVXIJURNJXZFN-JXMROGBWSA-N |
| XLogP | 3.51 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.00 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|