C18H17ClN2O5 — CID 34447783
N-[2-[[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]amino]ethyl]furan-2-carboxamide (PubChem CID 34447783) has the molecular formula C18H17ClN2O5 and a molecular weight of 376.80 g/mol. Its IUPAC name is N-[2-[[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 34447783 |
| Molecular Formula | C18H17ClN2O5 |
| Molecular Weight | 376.80 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-[2-[[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C18H17ClN2O5/c19-13-10-12(11-15-17(13)26-9-8-25-15)3-4-16(22)20-5-6-21-18(23)14-2-1-7-24-14/h1-4,7,10-11H,5-6,8-9H2,(H,20,22)(H,21,23)/b4-3+ |
| InChIKey | MMORNBSXDHTHOX-ONEGZZNKSA-N |
| XLogP | 2.26 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.80 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|