C16H13ClN2O5 — CID 9428090
N'-[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]furan-2-carbohydrazide (PubChem CID 9428090) has the molecular formula C16H13ClN2O5 and a molecular weight of 348.74 g/mol. Its IUPAC name is N'-[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]furan-2-carbohydrazide.
| Compound Name | N'-[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9428090 |
| Molecular Formula | C16H13ClN2O5 |
| Molecular Weight | 348.74 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | N'-[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]furan-2-carbohydrazide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)NNC(=O)c1ccco1 |
| InChI | InChI=1S/C16H13ClN2O5/c17-11-8-10(9-13-15(11)24-7-6-23-13)3-4-14(20)18-19-16(21)12-2-1-5-22-12/h1-5,8-9H,6-7H2,(H,18,20)(H,19,21)/b4-3+ |
| InChIKey | UDHRAMIXKUUWBQ-ONEGZZNKSA-N |
| XLogP | 2.18 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.74 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|