C18H15ClFN3O3S — CID 9427837
1-[[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]amino]-3-(2-fluorophenyl)thiourea (PubChem CID 9427837) has the molecular formula C18H15ClFN3O3S and a molecular weight of 407.85 g/mol. Its IUPAC name is 1-[[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]amino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]amino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9427837 |
| Molecular Formula | C18H15ClFN3O3S |
| Molecular Weight | 407.85 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | 1-[[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]amino]-3-(2-fluorophenyl)thiourea |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)NNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C18H15ClFN3O3S/c19-12-9-11(10-15-17(12)26-8-7-25-15)5-6-16(24)22-23-18(27)21-14-4-2-1-3-13(14)20/h1-6,9-10H,7-8H2,(H,22,24)(H2,21,23,27)/b6-5+ |
| InChIKey | FPTDCDYAIYKADV-AATRIKPKSA-N |
| XLogP | 3.28 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|