C17H22ClN3O3S — CID 9425987
1-tert-butyl-3-[[(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoyl]amino]thiourea (PubChem CID 9425987) has the molecular formula C17H22ClN3O3S and a molecular weight of 383.90 g/mol. Its IUPAC name is 1-tert-butyl-3-[[(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoyl]amino]thiourea |
|---|---|
| PubChem CID | 9425987 |
| Molecular Formula | C17H22ClN3O3S |
| Molecular Weight | 383.90 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | 1-tert-butyl-3-[[(E)-3-(6-chloro-3,4-dihydro-2H-1,5-benzodioxepin-8-yl)prop-2-enoyl]amino]thiourea |
| SMILES | CC(C)(C)NC(=S)NNC(=O)/C=C/c1cc(Cl)c2c(c1)OCCCO2 |
| InChI | InChI=1S/C17H22ClN3O3S/c1-17(2,3)19-16(25)21-20-14(22)6-5-11-9-12(18)15-13(10-11)23-7-4-8-24-15/h5-6,9-10H,4,7-8H2,1-3H3,(H,20,22)(H2,19,21,25)/b6-5+ |
| InChIKey | GQHJSAYBXXIKNV-AATRIKPKSA-N |
| XLogP | 2.81 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.90 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|