C18H14Cl2N2O4 — CID 9428053
3-chloro-N'-[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]benzohydrazide (PubChem CID 9428053) has the molecular formula C18H14Cl2N2O4 and a molecular weight of 393.23 g/mol. Its IUPAC name is 3-chloro-N'-[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]benzohydrazide.
| Compound Name | 3-chloro-N'-[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9428053 |
| Molecular Formula | C18H14Cl2N2O4 |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 3-chloro-N'-[(E)-3-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1cc(Cl)c2c(c1)OCCO2)NNC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N2O4/c19-13-3-1-2-12(10-13)18(24)22-21-16(23)5-4-11-8-14(20)17-15(9-11)25-6-7-26-17/h1-5,8-10H,6-7H2,(H,21,23)(H,22,24)/b5-4+ |
| InChIKey | RZXCODLEWDFUEO-SNAWJCMRSA-N |
| XLogP | 3.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|