C17H13Cl3FNO3 — CID 24564127
2,4-dichloro-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-5-fluorobenzamide (PubChem CID 24564127) has the molecular formula C17H13Cl3FNO3 and a molecular weight of 404.65 g/mol. Its IUPAC name is 2,4-dichloro-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-5-fluorobenzamide.
| Compound Name | 2,4-dichloro-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-5-fluorobenzamide |
|---|---|
| PubChem CID | 24564127 |
| Molecular Formula | C17H13Cl3FNO3 |
| Molecular Weight | 404.65 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 2,4-dichloro-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]-5-fluorobenzamide |
| SMILES | O=C(NCCc1cc(Cl)c2c(c1)OCCO2)c1cc(F)c(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl3FNO3/c18-11-8-12(19)14(21)7-10(11)17(23)22-2-1-9-5-13(20)16-15(6-9)24-3-4-25-16/h5-8H,1-4H2,(H,22,23) |
| InChIKey | SMQJYXKAJWCMSD-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.65 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|