C17H25ClN2O3 — CID 119697992
7-amino-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]heptanamide (PubChem CID 119697992) has the molecular formula C17H25ClN2O3 and a molecular weight of 340.85 g/mol. Its IUPAC name is 7-amino-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]heptanamide.
| Compound Name | 7-amino-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]heptanamide |
|---|---|
| PubChem CID | 119697992 |
| Molecular Formula | C17H25ClN2O3 |
| Molecular Weight | 340.85 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 7-amino-N-[2-(5-chloro-2,3-dihydro-1,4-benzodioxin-7-yl)ethyl]heptanamide |
| SMILES | NCCCCCCC(=O)NCCc1cc(Cl)c2c(c1)OCCO2 |
| InChI | InChI=1S/C17H25ClN2O3/c18-14-11-13(12-15-17(14)23-10-9-22-15)6-8-20-16(21)5-3-1-2-4-7-19/h11-12H,1-10,19H2,(H,20,21) |
| InChIKey | JPRPOLHNEQAEMO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.85 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|