C9H6F2O3 — CID 170358003
3,3-difluoro-2H-1,4-benzodioxine-6-carbaldehyde (PubChem CID 170358003) has the molecular formula C9H6F2O3 and a molecular weight of 200.14 g/mol. Its IUPAC name is 3,3-difluoro-2H-1,4-benzodioxine-6-carbaldehyde.
| Compound Name | 3,3-difluoro-2H-1,4-benzodioxine-6-carbaldehyde |
|---|---|
| PubChem CID | 170358003 |
| Molecular Formula | C9H6F2O3 |
| Molecular Weight | 200.14 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 3,3-difluoro-2H-1,4-benzodioxine-6-carbaldehyde |
| SMILES | O=Cc1ccc2c(c1)OC(F)(F)CO2 |
| InChI | InChI=1S/C9H6F2O3/c10-9(11)5-13-7-2-1-6(4-12)3-8(7)14-9/h1-4H,5H2 |
| InChIKey | JZPKLIJIVSYRPP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.14 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|