C11H10F2O3 — CID 84691748
3-(1,1-difluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde (PubChem CID 84691748) has the molecular formula C11H10F2O3 and a molecular weight of 228.19 g/mol. Its IUPAC name is 3-(1,1-difluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde.
| Compound Name | 3-(1,1-difluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde |
|---|---|
| PubChem CID | 84691748 |
| Molecular Formula | C11H10F2O3 |
| Molecular Weight | 228.19 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | 3-(1,1-difluoroethyl)-2,3-dihydro-1,4-benzodioxine-6-carbaldehyde |
| SMILES | CC(F)(F)C1COc2ccc(C=O)cc2O1 |
| InChI | InChI=1S/C11H10F2O3/c1-11(12,13)10-6-15-8-3-2-7(5-14)4-9(8)16-10/h2-5,10H,6H2,1H3 |
| InChIKey | UTKWPOXCLATRFT-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.19 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|