C15H19N — CID 122385230
(E)-3-(3,4-dimethylphenyl)-N-methyl-N-prop-2-ynylprop-2-en-1-amine (PubChem CID 122385230) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is (E)-3-(3,4-dimethylphenyl)-N-methyl-N-prop-2-ynylprop-2-en-1-amine.
| Compound Name | (E)-3-(3,4-dimethylphenyl)-N-methyl-N-prop-2-ynylprop-2-en-1-amine |
|---|---|
| PubChem CID | 122385230 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | (E)-3-(3,4-dimethylphenyl)-N-methyl-N-prop-2-ynylprop-2-en-1-amine |
| SMILES | C#CCN(C)C/C=C/c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C15H19N/c1-5-10-16(4)11-6-7-15-9-8-13(2)14(3)12-15/h1,6-9,12H,10-11H2,2-4H3/b7-6+ |
| InChIKey | FNWVOSCCORYNMO-VOTSOKGWSA-N |
| XLogP | 2.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|