C12H14O3 — CID 175063351
3-(3,4-dimethylphenyl)prop-2-enyl hydrogen carbonate (PubChem CID 175063351) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)prop-2-enyl hydrogen carbonate.
| Compound Name | 3-(3,4-dimethylphenyl)prop-2-enyl hydrogen carbonate |
|---|---|
| PubChem CID | 175063351 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 3-(3,4-dimethylphenyl)prop-2-enyl hydrogen carbonate |
| SMILES | Cc1ccc(C=CCOC(=O)O)cc1C |
| InChI | InChI=1S/C12H14O3/c1-9-5-6-11(8-10(9)2)4-3-7-15-12(13)14/h3-6,8H,7H2,1-2H3,(H,13,14) |
| InChIKey | XQULWFQDHRPQMW-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |