C25H22O3 — CID 2447236
[(E)-3-phenylprop-2-enyl] 2-(3,4-dimethylbenzoyl)benzoate (PubChem CID 2447236) has the molecular formula C25H22O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is [(E)-3-phenylprop-2-enyl] 2-(3,4-dimethylbenzoyl)benzoate.
| Compound Name | [(E)-3-phenylprop-2-enyl] 2-(3,4-dimethylbenzoyl)benzoate |
|---|---|
| PubChem CID | 2447236 |
| Molecular Formula | C25H22O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | [(E)-3-phenylprop-2-enyl] 2-(3,4-dimethylbenzoyl)benzoate |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)OC/C=C/c2ccccc2)cc1C |
| InChI | InChI=1S/C25H22O3/c1-18-14-15-21(17-19(18)2)24(26)22-12-6-7-13-23(22)25(27)28-16-8-11-20-9-4-3-5-10-20/h3-15,17H,16H2,1-2H3/b11-8+ |
| InChIKey | WKRZNKOKHXDNOL-DHZHZOJOSA-N |
| XLogP | 5.40 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |