C28H28N2O4 — CID 29352285
[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(3,4-dimethylbenzoyl)benzoate (PubChem CID 29352285) has the molecular formula C28H28N2O4 and a molecular weight of 456.54 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(3,4-dimethylbenzoyl)benzoate.
| Compound Name | [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(3,4-dimethylbenzoyl)benzoate |
|---|---|
| PubChem CID | 29352285 |
| Molecular Formula | C28H28N2O4 |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | [2-oxo-2-(4-phenylpiperazin-1-yl)ethyl] 2-(3,4-dimethylbenzoyl)benzoate |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)OCC(=O)N2CCN(c3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C28H28N2O4/c1-20-12-13-22(18-21(20)2)27(32)24-10-6-7-11-25(24)28(33)34-19-26(31)30-16-14-29(15-17-30)23-8-4-3-5-9-23/h3-13,18H,14-17,19H2,1-2H3 |
| InChIKey | OKDCMBLRNWIPON-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |