C16H21NO5 — CID 139085668
azanium;2-(3,4-dimethylbenzoyl)benzoate;dihydrate (PubChem CID 139085668) has the molecular formula C16H21NO5 and a molecular weight of 307.35 g/mol. Its IUPAC name is azanium;2-(3,4-dimethylbenzoyl)benzoate;dihydrate.
| Compound Name | azanium;2-(3,4-dimethylbenzoyl)benzoate;dihydrate |
|---|---|
| PubChem CID | 139085668 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | azanium;2-(3,4-dimethylbenzoyl)benzoate;dihydrate |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)[O-])cc1C.O.O.[NH4+] |
| InChI | InChI=1S/C16H14O3.H3N.2H2O/c1-10-7-8-12(9-11(10)2)15(17)13-5-3-4-6-14(13)16(18)19;;;/h3-9H,1-2H3,(H,18,19);1H3;2*1H2 |
| InChIKey | DIRAEJNVJAVOFE-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 156.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |