C21H23NO4 — CID 119249313
3-[[2-(3,4-dimethylbenzoyl)benzoyl]amino]-2,2-dimethylpropanoic acid (PubChem CID 119249313) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is 3-[[2-(3,4-dimethylbenzoyl)benzoyl]amino]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[[2-(3,4-dimethylbenzoyl)benzoyl]amino]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 119249313 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | 3-[[2-(3,4-dimethylbenzoyl)benzoyl]amino]-2,2-dimethylpropanoic acid |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)NCC(C)(C)C(=O)O)cc1C |
| InChI | InChI=1S/C21H23NO4/c1-13-9-10-15(11-14(13)2)18(23)16-7-5-6-8-17(16)19(24)22-12-21(3,4)20(25)26/h5-11H,12H2,1-4H3,(H,22,24)(H,25,26) |
| InChIKey | PRXSAVBAKIRJLF-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |