C14H16F3NO — CID 170489158
N-[4-[3-methyl-4-(trifluoromethyl)phenyl]but-3-enyl]acetamide (PubChem CID 170489158) has the molecular formula C14H16F3NO and a molecular weight of 271.28 g/mol. Its IUPAC name is N-[4-[3-methyl-4-(trifluoromethyl)phenyl]but-3-enyl]acetamide.
| Compound Name | N-[4-[3-methyl-4-(trifluoromethyl)phenyl]but-3-enyl]acetamide |
|---|---|
| PubChem CID | 170489158 |
| Molecular Formula | C14H16F3NO |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[4-[3-methyl-4-(trifluoromethyl)phenyl]but-3-enyl]acetamide |
| SMILES | CC(=O)NCCC=Cc1ccc(C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C14H16F3NO/c1-10-9-12(5-3-4-8-18-11(2)19)6-7-13(10)14(15,16)17/h3,5-7,9H,4,8H2,1-2H3,(H,18,19) |
| InChIKey | LWPWMLXEBTZGHA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|