C19H26O3 — CID 22164993
(E)-11-(3,4-dimethoxyphenyl)undec-10-en-2-yn-1-ol (PubChem CID 22164993) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is (E)-11-(3,4-dimethoxyphenyl)undec-10-en-2-yn-1-ol.
| Compound Name | (E)-11-(3,4-dimethoxyphenyl)undec-10-en-2-yn-1-ol |
|---|---|
| PubChem CID | 22164993 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | (E)-11-(3,4-dimethoxyphenyl)undec-10-en-2-yn-1-ol |
| SMILES | COc1ccc(/C=C/CCCCCCC#CCO)cc1OC |
| InChI | InChI=1S/C19H26O3/c1-21-18-14-13-17(16-19(18)22-2)12-10-8-6-4-3-5-7-9-11-15-20/h10,12-14,16,20H,3-8,15H2,1-2H3/b12-10+ |
| InChIKey | JWQXUFCXFSXSJL-ZRDIBKRKSA-N |
| XLogP | 4.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|