C18H21NO3 — CID 139923830
N-(3-tert-butyl-2,6-dihydroxyphenyl)-2-phenylacetamide (PubChem CID 139923830) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is N-(3-tert-butyl-2,6-dihydroxyphenyl)-2-phenylacetamide.
| Compound Name | N-(3-tert-butyl-2,6-dihydroxyphenyl)-2-phenylacetamide |
|---|---|
| PubChem CID | 139923830 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | N-(3-tert-butyl-2,6-dihydroxyphenyl)-2-phenylacetamide |
| SMILES | CC(C)(C)c1ccc(O)c(NC(=O)Cc2ccccc2)c1O |
| InChI | InChI=1S/C18H21NO3/c1-18(2,3)13-9-10-14(20)16(17(13)22)19-15(21)11-12-7-5-4-6-8-12/h4-10,20,22H,11H2,1-3H3,(H,19,21) |
| InChIKey | QFYADYWMFWLQBP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|