C14H21NO2 — CID 113354468
N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-phenylacetamide (PubChem CID 113354468) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-phenylacetamide.
| Compound Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 113354468 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-phenylacetamide |
| SMILES | CC(C)(O)C(C)(C)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c1-13(2,14(3,4)17)15-12(16)10-11-8-6-5-7-9-11/h5-9,17H,10H2,1-4H3,(H,15,16) |
| InChIKey | KYRUIOFRCHDATG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |