C15H26BNO5 — CID 70153085
2,3-dimethylbutane-2,3-diol;[(2-phenylacetyl)amino]methylboronic acid (PubChem CID 70153085) has the molecular formula C15H26BNO5 and a molecular weight of 311.19 g/mol. Its IUPAC name is 2,3-dimethylbutane-2,3-diol;[(2-phenylacetyl)amino]methylboronic acid.
| Compound Name | 2,3-dimethylbutane-2,3-diol;[(2-phenylacetyl)amino]methylboronic acid |
|---|---|
| PubChem CID | 70153085 |
| Molecular Formula | C15H26BNO5 |
| Molecular Weight | 311.19 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2,3-dimethylbutane-2,3-diol;[(2-phenylacetyl)amino]methylboronic acid |
| SMILES | CC(C)(O)C(C)(C)O.O=C(Cc1ccccc1)NCB(O)O |
| InChI | InChI=1S/C9H12BNO3.C6H14O2/c12-9(11-7-10(13)14)6-8-4-2-1-3-5-8;1-5(2,7)6(3,4)8/h1-5,13-14H,6-7H2,(H,11,12);7-8H,1-4H3 |
| InChIKey | DPSBANOBQNVPAI-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 110.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.19 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|