C18H23NO2 — CID 103895382
N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-naphthalen-1-ylacetamide (PubChem CID 103895382) has the molecular formula C18H23NO2 and a molecular weight of 285.39 g/mol. Its IUPAC name is N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-naphthalen-1-ylacetamide.
| Compound Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-naphthalen-1-ylacetamide |
|---|---|
| PubChem CID | 103895382 |
| Molecular Formula | C18H23NO2 |
| Molecular Weight | 285.39 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-naphthalen-1-ylacetamide |
| SMILES | CC(C)(O)C(C)(C)NC(=O)Cc1cccc2ccccc12 |
| InChI | InChI=1S/C18H23NO2/c1-17(2,18(3,4)21)19-16(20)12-14-10-7-9-13-8-5-6-11-15(13)14/h5-11,21H,12H2,1-4H3,(H,19,20) |
| InChIKey | FWHAXBYTEXBUIA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.39 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |