C14H17NO — CID 3649343
N-(3-methylpent-1-yn-3-yl)-2-phenylacetamide (PubChem CID 3649343) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is N-(3-methylpent-1-yn-3-yl)-2-phenylacetamide.
| Compound Name | N-(3-methylpent-1-yn-3-yl)-2-phenylacetamide |
|---|---|
| PubChem CID | 3649343 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | N-(3-methylpent-1-yn-3-yl)-2-phenylacetamide |
| SMILES | C#CC(C)(CC)NC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO/c1-4-14(3,5-2)15-13(16)11-12-9-7-6-8-10-12/h1,6-10H,5,11H2,2-3H3,(H,15,16) |
| InChIKey | MHDWGTMDKXUYML-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|