C19H23NO5 — CID 139923822
N-(3-tert-butyl-2,6-dihydroxyphenyl)-3,4-dimethoxybenzamide (PubChem CID 139923822) has the molecular formula C19H23NO5 and a molecular weight of 345.40 g/mol. Its IUPAC name is N-(3-tert-butyl-2,6-dihydroxyphenyl)-3,4-dimethoxybenzamide.
| Compound Name | N-(3-tert-butyl-2,6-dihydroxyphenyl)-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 139923822 |
| Molecular Formula | C19H23NO5 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(3-tert-butyl-2,6-dihydroxyphenyl)-3,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2c(O)ccc(C(C)(C)C)c2O)cc1OC |
| InChI | InChI=1S/C19H23NO5/c1-19(2,3)12-7-8-13(21)16(17(12)22)20-18(23)11-6-9-14(24-4)15(10-11)25-5/h6-10,21-22H,1-5H3,(H,20,23) |
| InChIKey | STWQNEYZDCPRGG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|