C15H12Cl3NO4 — CID 5228987
3,4-dimethoxy-N-(2,3,5-trichloro-4-hydroxyphenyl)benzamide (PubChem CID 5228987) has the molecular formula C15H12Cl3NO4 and a molecular weight of 376.62 g/mol. Its IUPAC name is 3,4-dimethoxy-N-(2,3,5-trichloro-4-hydroxyphenyl)benzamide.
| Compound Name | 3,4-dimethoxy-N-(2,3,5-trichloro-4-hydroxyphenyl)benzamide |
|---|---|
| PubChem CID | 5228987 |
| Molecular Formula | C15H12Cl3NO4 |
| Molecular Weight | 376.62 g/mol |
| Exact Mass | 374.98 |
| IUPAC Name | 3,4-dimethoxy-N-(2,3,5-trichloro-4-hydroxyphenyl)benzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(Cl)c(O)c(Cl)c2Cl)cc1OC |
| InChI | InChI=1S/C15H12Cl3NO4/c1-22-10-4-3-7(5-11(10)23-2)15(21)19-9-6-8(16)14(20)13(18)12(9)17/h3-6,20H,1-2H3,(H,19,21) |
| InChIKey | XGODXUOAZFTBQI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|