C27H32N2O — CID 135598899
4-[(E)-N-anilino-C-phenylcarbonimidoyl]-2,6-ditert-butylphenol (PubChem CID 135598899) has the molecular formula C27H32N2O and a molecular weight of 400.57 g/mol. Its IUPAC name is 4-[(E)-N-anilino-C-phenylcarbonimidoyl]-2,6-ditert-butylphenol.
| Compound Name | 4-[(E)-N-anilino-C-phenylcarbonimidoyl]-2,6-ditert-butylphenol |
|---|---|
| PubChem CID | 135598899 |
| Molecular Formula | C27H32N2O |
| Molecular Weight | 400.57 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 4-[(E)-N-anilino-C-phenylcarbonimidoyl]-2,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(/C(=N/Nc2ccccc2)c2ccccc2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C27H32N2O/c1-26(2,3)22-17-20(18-23(25(22)30)27(4,5)6)24(19-13-9-7-10-14-19)29-28-21-15-11-8-12-16-21/h7-18,28,30H,1-6H3/b29-24+ |
| InChIKey | FZBHWYPEGIEWNL-RMLRFSFXSA-N |
| XLogP | 6.85 |
| TPSA | 44.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.57 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|