C24H32N2O2 — CID 139795293
3,5-ditert-butyl-4-hydroxy-N-(1-phenylpropylideneamino)benzamide (PubChem CID 139795293) has the molecular formula C24H32N2O2 and a molecular weight of 380.53 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-(1-phenylpropylideneamino)benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-(1-phenylpropylideneamino)benzamide |
|---|---|
| PubChem CID | 139795293 |
| Molecular Formula | C24H32N2O2 |
| Molecular Weight | 380.53 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-(1-phenylpropylideneamino)benzamide |
| SMILES | CCC(=NNC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O2/c1-8-20(16-12-10-9-11-13-16)25-26-22(28)17-14-18(23(2,3)4)21(27)19(15-17)24(5,6)7/h9-15,27H,8H2,1-7H3,(H,26,28) |
| InChIKey | BOKHEQDCYDLVSY-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.53 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|