C29H34N2O2 — CID 6382208
3,5-ditert-butyl-4-hydroxy-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]benzamide (PubChem CID 6382208) has the molecular formula C29H34N2O2 and a molecular weight of 442.60 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]benzamide |
|---|---|
| PubChem CID | 6382208 |
| Molecular Formula | C29H34N2O2 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-[(Z)-1-(4-phenylphenyl)ethylideneamino]benzamide |
| SMILES | C/C(=N/NC(=O)c1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N2O2/c1-19(20-13-15-22(16-14-20)21-11-9-8-10-12-21)30-31-27(33)23-17-24(28(2,3)4)26(32)25(18-23)29(5,6)7/h8-18,32H,1-7H3,(H,31,33)/b30-19- |
| InChIKey | OEQHSJFJNBTIMJ-FSGOGVSDSA-N |
| XLogP | 6.81 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|