C26H30N2O3 — CID 135437725
3,5-ditert-butyl-4-hydroxy-N-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]benzamide (PubChem CID 135437725) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 135437725 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-[(E)-(3-hydroxynaphthalen-2-yl)methylideneamino]benzamide |
| SMILES | CC(C)(C)c1cc(C(=O)N/N=C/c2cc3ccccc3cc2O)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C26H30N2O3/c1-25(2,3)20-12-18(13-21(23(20)30)26(4,5)6)24(31)28-27-15-19-11-16-9-7-8-10-17(16)14-22(19)29/h7-15,29-30H,1-6H3,(H,28,31)/b27-15+ |
| InChIKey | JQROEADHAYFIIL-JFLMPSFJSA-N |
| XLogP | 5.61 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|