C25H32N2O4 — CID 139795276
3,5-ditert-butyl-4-hydroxy-N-[3-(2-hydroxy-3-methoxyphenyl)prop-2-enylideneamino]benzamide (PubChem CID 139795276) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hydroxy-N-[3-(2-hydroxy-3-methoxyphenyl)prop-2-enylideneamino]benzamide.
| Compound Name | 3,5-ditert-butyl-4-hydroxy-N-[3-(2-hydroxy-3-methoxyphenyl)prop-2-enylideneamino]benzamide |
|---|---|
| PubChem CID | 139795276 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 3,5-ditert-butyl-4-hydroxy-N-[3-(2-hydroxy-3-methoxyphenyl)prop-2-enylideneamino]benzamide |
| SMILES | COc1cccc(C=CC=NNC(=O)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c1O |
| InChI | InChI=1S/C25H32N2O4/c1-24(2,3)18-14-17(15-19(22(18)29)25(4,5)6)23(30)27-26-13-9-11-16-10-8-12-20(31-7)21(16)28/h8-15,28-29H,1-7H3,(H,27,30) |
| InChIKey | WYYYNIXMRZMVMU-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|