C23H28O — CID 5154900
3-(3,5-ditert-butylphenyl)-1-phenylprop-2-en-1-one (PubChem CID 5154900) has the molecular formula C23H28O and a molecular weight of 320.48 g/mol. Its IUPAC name is 3-(3,5-ditert-butylphenyl)-1-phenylprop-2-en-1-one.
| Compound Name | 3-(3,5-ditert-butylphenyl)-1-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 5154900 |
| Molecular Formula | C23H28O |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.21 |
| IUPAC Name | 3-(3,5-ditert-butylphenyl)-1-phenylprop-2-en-1-one |
| SMILES | CC(C)(C)c1cc(C=CC(=O)c2ccccc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C23H28O/c1-22(2,3)19-14-17(15-20(16-19)23(4,5)6)12-13-21(24)18-10-8-7-9-11-18/h7-16H,1-6H3 |
| InChIKey | UYUZSHDRJWFQML-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|