C20H15F3O4 — CID 156702978
(E)-3-(4,7-dimethoxy-1-benzofuran-5-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 156702978) has the molecular formula C20H15F3O4 and a molecular weight of 376.33 g/mol. Its IUPAC name is (E)-3-(4,7-dimethoxy-1-benzofuran-5-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-(4,7-dimethoxy-1-benzofuran-5-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 156702978 |
| Molecular Formula | C20H15F3O4 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | (E)-3-(4,7-dimethoxy-1-benzofuran-5-yl)-1-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | COc1c(/C=C/C(=O)c2cccc(C(F)(F)F)c2)cc(OC)c2occc12 |
| InChI | InChI=1S/C20H15F3O4/c1-25-17-11-13(18(26-2)15-8-9-27-19(15)17)6-7-16(24)12-4-3-5-14(10-12)20(21,22)23/h3-11H,1-2H3/b7-6+ |
| InChIKey | HMTMRULJRDVGGW-VOTSOKGWSA-N |
| XLogP | 5.36 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|