C26H36O6Si — CID 144536058
tert-butyl-[2-methoxy-5-(7,8,9-trimethoxy-2,3-dihydro-1-benzoxepin-5-yl)phenoxy]-dimethylsilane (PubChem CID 144536058) has the molecular formula C26H36O6Si and a molecular weight of 472.65 g/mol. Its IUPAC name is tert-butyl-[2-methoxy-5-(7,8,9-trimethoxy-2,3-dihydro-1-benzoxepin-5-yl)phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-methoxy-5-(7,8,9-trimethoxy-2,3-dihydro-1-benzoxepin-5-yl)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 144536058 |
| Molecular Formula | C26H36O6Si |
| Molecular Weight | 472.65 g/mol |
| Exact Mass | 472.23 |
| IUPAC Name | tert-butyl-[2-methoxy-5-(7,8,9-trimethoxy-2,3-dihydro-1-benzoxepin-5-yl)phenoxy]-dimethylsilane |
| SMILES | COc1ccc(C2=CCCOc3c2cc(OC)c(OC)c3OC)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H36O6Si/c1-26(2,3)33(8,9)32-21-15-17(12-13-20(21)27-4)18-11-10-14-31-23-19(18)16-22(28-5)24(29-6)25(23)30-7/h11-13,15-16H,10,14H2,1-9H3 |
| InChIKey | PEMXVZHQXCUJIS-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.65 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|