C27H38O5Si — CID 123844169
tert-butyl-[2-methoxy-5-(1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenoxy]-dimethylsilane (PubChem CID 123844169) has the molecular formula C27H38O5Si and a molecular weight of 470.68 g/mol. Its IUPAC name is tert-butyl-[2-methoxy-5-(1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-methoxy-5-(1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123844169 |
| Molecular Formula | C27H38O5Si |
| Molecular Weight | 470.68 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | tert-butyl-[2-methoxy-5-(1,2,3-trimethoxy-8,9-dihydro-7H-benzo[7]annulen-5-yl)phenoxy]-dimethylsilane |
| SMILES | COc1ccc(C2=CCCCc3c2cc(OC)c(OC)c3OC)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H38O5Si/c1-27(2,3)33(8,9)32-23-16-18(14-15-22(23)28-4)19-12-10-11-13-20-21(19)17-24(29-5)26(31-7)25(20)30-6/h12,14-17H,10-11,13H2,1-9H3 |
| InChIKey | VLKMOKMROMCIBE-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.68 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|