C29H40O6Si — CID 72725155
2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]acetaldehyde (PubChem CID 72725155) has the molecular formula C29H40O6Si and a molecular weight of 512.72 g/mol. Its IUPAC name is 2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]acetaldehyde.
| Compound Name | 2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]acetaldehyde |
|---|---|
| PubChem CID | 72725155 |
| Molecular Formula | C29H40O6Si |
| Molecular Weight | 512.72 g/mol |
| Exact Mass | 512.26 |
| IUPAC Name | 2-[1-[tert-butyl(dimethyl)silyl]oxy-2-methoxy-5-(3,4,5-trimethoxyphenyl)-8,9-dihydro-7H-benzo[7]annulen-6-yl]acetaldehyde |
| SMILES | COc1cc(C2=C(CC=O)CCCc3c2ccc(OC)c3O[Si](C)(C)C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C29H40O6Si/c1-29(2,3)36(8,9)35-27-22-12-10-11-19(15-16-30)26(21(22)13-14-23(27)31-4)20-17-24(32-5)28(34-7)25(18-20)33-6/h13-14,16-18H,10-12,15H2,1-9H3 |
| InChIKey | XXXRVNGDFKQZFX-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.72 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|