C21H21Na2O9P — CID 140663643
disodium;[2-methoxy-5-(1,2,3-trimethoxy-7-oxo-8,9-dihydrobenzo[7]annulen-5-yl)phenyl] phosphate (PubChem CID 140663643) has the molecular formula C21H21Na2O9P and a molecular weight of 494.34 g/mol. Its IUPAC name is disodium;[2-methoxy-5-(1,2,3-trimethoxy-7-oxo-8,9-dihydrobenzo[7]annulen-5-yl)phenyl] phosphate.
| Compound Name | disodium;[2-methoxy-5-(1,2,3-trimethoxy-7-oxo-8,9-dihydrobenzo[7]annulen-5-yl)phenyl] phosphate |
|---|---|
| PubChem CID | 140663643 |
| Molecular Formula | C21H21Na2O9P |
| Molecular Weight | 494.34 g/mol |
| Exact Mass | 494.07 |
| IUPAC Name | disodium;[2-methoxy-5-(1,2,3-trimethoxy-7-oxo-8,9-dihydrobenzo[7]annulen-5-yl)phenyl] phosphate |
| SMILES | COc1ccc(C2=CC(=O)CCc3c2cc(OC)c(OC)c3OC)cc1OP(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C21H23O9P.2Na/c1-26-17-8-5-12(9-18(17)30-31(23,24)25)15-10-13(22)6-7-14-16(15)11-19(27-2)21(29-4)20(14)28-3;;/h5,8-11H,6-7H2,1-4H3,(H2,23,24,25);;/q;2*+1/p-2 |
| InChIKey | DWEHPFKFXPWFBB-UHFFFAOYSA-L |
| XLogP | -4.12 |
| TPSA | 126.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.34 |
| LogP ≤ 5 | -4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|