C19H19Na2O8P — CID 140925772
disodium;[5-methoxy-1-(3,4,5-trimethoxyphenyl)-3H-inden-4-yl] phosphate (PubChem CID 140925772) has the molecular formula C19H19Na2O8P and a molecular weight of 452.31 g/mol. Its IUPAC name is disodium;[5-methoxy-1-(3,4,5-trimethoxyphenyl)-3H-inden-4-yl] phosphate.
| Compound Name | disodium;[5-methoxy-1-(3,4,5-trimethoxyphenyl)-3H-inden-4-yl] phosphate |
|---|---|
| PubChem CID | 140925772 |
| Molecular Formula | C19H19Na2O8P |
| Molecular Weight | 452.31 g/mol |
| Exact Mass | 452.06 |
| IUPAC Name | disodium;[5-methoxy-1-(3,4,5-trimethoxyphenyl)-3H-inden-4-yl] phosphate |
| SMILES | COc1cc(C2=CCc3c2ccc(OC)c3OP(=O)([O-])[O-])cc(OC)c1OC.[Na+].[Na+] |
| InChI | InChI=1S/C19H21O8P.2Na/c1-23-15-8-7-13-12(5-6-14(13)18(15)27-28(20,21)22)11-9-16(24-2)19(26-4)17(10-11)25-3;;/h5,7-10H,6H2,1-4H3,(H2,20,21,22);;/q;2*+1/p-2 |
| InChIKey | QKGHXGLAKKVXCW-UHFFFAOYSA-L |
| XLogP | -4.08 |
| TPSA | 109.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.31 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|