C26H23O10PS-2 — CID 59892921
[2-methoxy-5-[4-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzothiophen-2-yl]phenyl] phosphate (PubChem CID 59892921) has the molecular formula C26H23O10PS-2 and a molecular weight of 558.50 g/mol. Its IUPAC name is [2-methoxy-5-[4-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzothiophen-2-yl]phenyl] phosphate.
| Compound Name | [2-methoxy-5-[4-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzothiophen-2-yl]phenyl] phosphate |
|---|---|
| PubChem CID | 59892921 |
| Molecular Formula | C26H23O10PS-2 |
| Molecular Weight | 558.50 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | [2-methoxy-5-[4-methoxy-3-(3,4,5-trimethoxybenzoyl)-1-benzothiophen-2-yl]phenyl] phosphate |
| SMILES | COc1ccc(-c2sc3cccc(OC)c3c2C(=O)c2cc(OC)c(OC)c(OC)c2)cc1OP(=O)([O-])[O-] |
| InChI | InChI=1S/C26H25O10PS/c1-31-16-10-9-14(11-18(16)36-37(28,29)30)26-23(22-17(32-2)7-6-8-21(22)38-26)24(27)15-12-19(33-3)25(35-5)20(13-15)34-4/h6-13H,1-5H3,(H2,28,29,30)/p-2 |
| InChIKey | WALFLNGXKXLXRI-UHFFFAOYSA-L |
| XLogP | 4.05 |
| TPSA | 135.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|