C20H20O8P- — CID 59838323
methyl-[[3-(3,4,5-trimethoxybenzoyl)-2H-chromen-8-yl]oxy]phosphinate (PubChem CID 59838323) has the molecular formula C20H20O8P- and a molecular weight of 419.35 g/mol. Its IUPAC name is methyl-[[3-(3,4,5-trimethoxybenzoyl)-2H-chromen-8-yl]oxy]phosphinate.
| Compound Name | methyl-[[3-(3,4,5-trimethoxybenzoyl)-2H-chromen-8-yl]oxy]phosphinate |
|---|---|
| PubChem CID | 59838323 |
| Molecular Formula | C20H20O8P- |
| Molecular Weight | 419.35 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | methyl-[[3-(3,4,5-trimethoxybenzoyl)-2H-chromen-8-yl]oxy]phosphinate |
| SMILES | COc1cc(C(=O)C2=Cc3cccc(OP(C)(=O)[O-])c3OC2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21O8P/c1-24-16-9-13(10-17(25-2)20(16)26-3)18(21)14-8-12-6-5-7-15(19(12)27-11-14)28-29(4,22)23/h5-10H,11H2,1-4H3,(H,22,23)/p-1 |
| InChIKey | MKOOMVNYYWWTCP-UHFFFAOYSA-M |
| XLogP | 2.93 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.35 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|