C21H22O7 — CID 59838307
(6,7-dimethoxy-2H-chromen-3-yl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 59838307) has the molecular formula C21H22O7 and a molecular weight of 386.40 g/mol. Its IUPAC name is (6,7-dimethoxy-2H-chromen-3-yl)-(3,4,5-trimethoxyphenyl)methanone.
| Compound Name | (6,7-dimethoxy-2H-chromen-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 59838307 |
| Molecular Formula | C21H22O7 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (6,7-dimethoxy-2H-chromen-3-yl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc2c(cc1OC)OCC(C(=O)c1cc(OC)c(OC)c(OC)c1)=C2 |
| InChI | InChI=1S/C21H22O7/c1-23-16-7-12-6-14(11-28-15(12)10-17(16)24-2)20(22)13-8-18(25-3)21(27-5)19(9-13)26-4/h6-10H,11H2,1-5H3 |
| InChIKey | BEUHHJBFQIBRDU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |