C20H19NO6 — CID 139932860
methyl 2-[(6,7-dimethoxy-2H-chromene-3-carbonyl)amino]benzoate (PubChem CID 139932860) has the molecular formula C20H19NO6 and a molecular weight of 369.37 g/mol. Its IUPAC name is methyl 2-[(6,7-dimethoxy-2H-chromene-3-carbonyl)amino]benzoate.
| Compound Name | methyl 2-[(6,7-dimethoxy-2H-chromene-3-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 139932860 |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | methyl 2-[(6,7-dimethoxy-2H-chromene-3-carbonyl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1=Cc2cc(OC)c(OC)cc2OC1 |
| InChI | InChI=1S/C20H19NO6/c1-24-17-9-12-8-13(11-27-16(12)10-18(17)25-2)19(22)21-15-7-5-4-6-14(15)20(23)26-3/h4-10H,11H2,1-3H3,(H,21,22) |
| InChIKey | IYRKFXKEEKCHOH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |