C22H27NO4 — CID 89416873
2-methoxy-5-(1,2,3-trimethoxy-7-methyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)aniline (PubChem CID 89416873) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-methoxy-5-(1,2,3-trimethoxy-7-methyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)aniline.
| Compound Name | 2-methoxy-5-(1,2,3-trimethoxy-7-methyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)aniline |
|---|---|
| PubChem CID | 89416873 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 2-methoxy-5-(1,2,3-trimethoxy-7-methyl-8,9-dihydro-7H-benzo[7]annulen-5-yl)aniline |
| SMILES | COc1ccc(C2=CC(C)CCc3c2cc(OC)c(OC)c3OC)cc1N |
| InChI | InChI=1S/C22H27NO4/c1-13-6-8-15-17(12-20(25-3)22(27-5)21(15)26-4)16(10-13)14-7-9-19(24-2)18(23)11-14/h7,9-13H,6,8,23H2,1-5H3 |
| InChIKey | WPEWEMSLWSJCBS-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|